CAS 32281-36-0 appears in our catalog under these names: Benzo(1,2-b:4,5-b‚Ä≤)dithiophene-4,8-dione, 95-<97%, Benzo(1,2-b:4,5-b‚Ä≤)dithiophene-4,8-dione, ≥97-<99%, Benzo(1,2–b:4,5–b')dithiophene–4,8–dione, Benzo(1,2-b:4,5-b')dithiophene-4,8-dione, Benzo[1,2-b:4,5-b']dithiophene-4,8-dione, >98.0%(GC). Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 25g, 5g.
Thieno[2,3-f][1]benzothiole-4,8-dione (CAS 32281-36-0) is a chemical compound with the molecular formula C10H4O2S2 and a molecular weight of 220.3 g/mol. IUPAC name: thieno[2,3-f][1]benzothiole-4,8-dione. InChIKey: SIUXRPJYVQQBAF-UHFFFAOYSA-N.
| Molecular formula | C10H4O2S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | thieno[2,3-f][1]benzothiole-4,8-dione |
| InChIKey | SIUXRPJYVQQBAF-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=O)C3=C(C2=O)C=CS3 |
Computed by PubChem (NCBI)