CAS 24248-42-8 is the registry number for Benzoin Hemisuccinate. Offered by: TRC. Available pack sizes: 750mg.
4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoate (CAS 24248-42-8) is a chemical compound with the molecular formula C18H15O5- and a molecular weight of 311.3 g/mol. IUPAC name: 4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoate. InChIKey: JIXPXNUZJCCKGO-UHFFFAOYSA-M.
| Molecular formula | C18H15O5- |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoate |
| InChIKey | JIXPXNUZJCCKGO-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)OC(=O)CCC(=O)[O-] |
Computed by PubChem (NCBI)