Products 306935-85-3
CAS 306935-85-3 is the registry number for Benzoin Hemisuccinate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5000mg, 1000mg.
4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoic acid (CAS 306935-85-3) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoic acid. InChIKey: JIXPXNUZJCCKGO-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 4-oxo-4-(2-oxo-1,2-diphenylethoxy)butanoic acid |
| InChIKey | JIXPXNUZJCCKGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=CC=C2)OC(=O)CCC(=O)O |
Computed by PubChem (NCBI)