CAS 24248-68-8 is the registry number for 2-Amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide (CAS 24248-68-8) is a chemical compound with the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. IUPAC name: 2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide. InChIKey: RHYVGTRJURYESC-UHFFFAOYSA-N.
| Molecular formula | C8H11N3OS |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2-amino-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
| InChIKey | RHYVGTRJURYESC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=C(S2)N)C(=O)N |
Computed by PubChem (NCBI)