CAS 74537-77-2 is the registry number for 2-((4,6-Dimethylpyrimidin-2-yl)thio)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide (CAS 74537-77-2) is a chemical compound with the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide. InChIKey: CYWIRZGTWFPTMH-UHFFFAOYSA-N.
| Molecular formula | C8H11N3OS |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetamide |
| InChIKey | CYWIRZGTWFPTMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC(=O)N)C |
Computed by PubChem (NCBI)