CAS 2426-61-1 is the registry number for 2-Benzyloxy-3-methoxy-6-nitrobenzaldehyde. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 25g.
3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde (CAS 2426-61-1) is a chemical compound with the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. IUPAC name: 3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde. InChIKey: QVHGRFZRDBMAHJ-UHFFFAOYSA-N.
| Molecular formula | C15H13NO5 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 3-methoxy-6-nitro-2-phenylmethoxybenzaldehyde |
| InChIKey | QVHGRFZRDBMAHJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)[N+](=O)[O-])C=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)