CAS 24293-28-5 is the registry number for Pentane-1,5-diyl bis(4-methylbenzenesulfonate) 98%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.
5-(4-methylphenyl)sulfonyloxypentyl 4-methylbenzenesulfonate (CAS 24293-28-5) is a chemical compound with the molecular formula C19H24O6S2 and a molecular weight of 412.5 g/mol. IUPAC name: 5-(4-methylphenyl)sulfonyloxypentyl 4-methylbenzenesulfonate. InChIKey: GMMNFKKJUMYAPM-UHFFFAOYSA-N.
| Molecular formula | C19H24O6S2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 5-(4-methylphenyl)sulfonyloxypentyl 4-methylbenzenesulfonate |
| InChIKey | GMMNFKKJUMYAPM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCCCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)