Products 24293-28-5

CAS 24293-28-5 is the registry number for Pentane-1,5-diyl bis(4-methylbenzenesulfonate) 98%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

5-(4-methylphenyl)sulfonyloxypentyl 4-methylbenzenesulfonate (CAS 24293-28-5) is a chemical compound with the molecular formula C19H24O6S2 and a molecular weight of 412.5 g/mol. IUPAC name: 5-(4-methylphenyl)sulfonyloxypentyl 4-methylbenzenesulfonate. InChIKey: GMMNFKKJUMYAPM-UHFFFAOYSA-N.

Identity
Molecular formulaC19H24O6S2
Molecular weight412.5 g/mol
IUPAC name5-(4-methylphenyl)sulfonyloxypentyl 4-methylbenzenesulfonate
InChIKeyGMMNFKKJUMYAPM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCCCCOS(=O)(=O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)