CAS 2429952-20-3 is the registry number for Calcium Dobesilate Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 2,5-dihydroxybenzenesulfonate (CAS 2429952-20-3) is a chemical compound with the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. IUPAC name: propan-2-yl 2,5-dihydroxybenzenesulfonate. InChIKey: AAJJZUWUJDJYJH-UHFFFAOYSA-N.
| Molecular formula | C9H12O5S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | propan-2-yl 2,5-dihydroxybenzenesulfonate |
| InChIKey | AAJJZUWUJDJYJH-UHFFFAOYSA-N |
| SMILES | CC(C)OS(=O)(=O)C1=C(C=CC(=C1)O)O |
Computed by PubChem (NCBI)