Products 2429952-20-3

CAS 2429952-20-3 is the registry number for Calcium Dobesilate Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Propan-2-yl 2,5-dihydroxybenzenesulfonate (CAS 2429952-20-3) is a chemical compound with the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. IUPAC name: propan-2-yl 2,5-dihydroxybenzenesulfonate. InChIKey: AAJJZUWUJDJYJH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O5S
Molecular weight232.26 g/mol
IUPAC namepropan-2-yl 2,5-dihydroxybenzenesulfonate
InChIKeyAAJJZUWUJDJYJH-UHFFFAOYSA-N
SMILESCC(C)OS(=O)(=O)C1=C(C=CC(=C1)O)O

Computed by PubChem (NCBI)