Products 2771346-02-0

CAS 2771346-02-0 is the registry number for 5-(2-(Methylsulfonyl)propan-2-yl)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(2-methylsulfonylpropan-2-yl)furan-2-carboxylic acid (CAS 2771346-02-0) is a chemical compound with the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. IUPAC name: 5-(2-methylsulfonylpropan-2-yl)furan-2-carboxylic acid. InChIKey: SJWHSDVCDJXYHN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O5S
Molecular weight232.26 g/mol
IUPAC name5-(2-methylsulfonylpropan-2-yl)furan-2-carboxylic acid
InChIKeySJWHSDVCDJXYHN-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=C(O1)C(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)