CAS 243139-62-0 is the registry number for 4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoic acid (CAS 243139-62-0) is a chemical compound with the molecular formula C6H5F7O2 and a molecular weight of 242.09 g/mol. IUPAC name: 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoic acid. InChIKey: ZKMKCYOZMOVHGJ-UHFFFAOYSA-N.
| Molecular formula | C6H5F7O2 |
|---|---|
| Molecular weight | 242.09 g/mol |
| IUPAC name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentanoic acid |
| InChIKey | ZKMKCYOZMOVHGJ-UHFFFAOYSA-N |
| SMILES | C(CC(C(F)(F)F)(C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)