Products 356-27-4
CAS 356-27-4 appears in our catalog under these names: Ethyl heptafluorobutyrate, 95%, Ethyl Heptafluorobutyrate, Ethyl Heptafluorobutyrate, >97.0%(GC), Ethyl perfluorobutyrate 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g.
Ethyl 2,2,3,3,4,4,4-heptafluorobutanoate (CAS 356-27-4) is a chemical compound with the molecular formula C6H5F7O2 and a molecular weight of 242.09 g/mol. IUPAC name: ethyl 2,2,3,3,4,4,4-heptafluorobutanoate. InChIKey: JVHJRIQPDBCRRE-UHFFFAOYSA-N.
| Molecular formula | C6H5F7O2 |
|---|---|
| Molecular weight | 242.09 g/mol |
| IUPAC name | ethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChIKey | JVHJRIQPDBCRRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Ethyl heptafluorobutyrate, Ethyl 2,2,3,3,4,4,4-heptafluorobutanoate, Butanoic acid, heptafluoro-, ethyl ester, BUTYRIC ACID, HEPTAFLUORO-, ETHYL ESTER, Butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, ethyl ester, 4-02-00-00813 (Beilstein Handbook Reference), Butyric acid, heptafluoro, ethyl ester, Butanoic acid, heptafluoro, ethyl ester, Butanoic acid, 2,2,3,3,4,4,4heptafluoro, ethyl ester, Ethyl perfluorobutyrate