CAS 243145-00-8 appears in our catalog under these names: Vildagliptin Impurity 7, Vildagliptin Impurity 29, Vildagliptin Impurity 15, 1-Amino-3-nitroadamantane. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-nitroadamantan-1-amine (CAS 243145-00-8) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: 3-nitroadamantan-1-amine. InChIKey: IGRDMGWZTHMMAM-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 3-nitroadamantan-1-amine |
| InChIKey | IGRDMGWZTHMMAM-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)[N+](=O)[O-])N |
Computed by PubChem (NCBI)