CAS 2433-21-8 is the registry number for N,N-Diethyl-3-nitrobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
N,N-diethyl-3-nitrobenzamide (CAS 2433-21-8) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: N,N-diethyl-3-nitrobenzamide. InChIKey: CKXQMTJOJKBZGD-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | N,N-diethyl-3-nitrobenzamide |
| InChIKey | CKXQMTJOJKBZGD-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)