CAS 2434588-52-8 is the registry number for Rel-(3R,4R)-3-amino-4-((tert-butyldimethylsilyl)oxy)cyclopentan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(3R,4R)-3-amino-4-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol (CAS 2434588-52-8) is a chemical compound with the molecular formula C11H25NO2Si and a molecular weight of 231.41 g/mol. IUPAC name: trans-(3R,4R)-3-amino-4-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol. InChIKey: DOBQVWUPIRZKPZ-VXRWAFEHSA-N.
| Molecular formula | C11H25NO2Si |
|---|---|
| Molecular weight | 231.41 g/mol |
| IUPAC name | trans-(3R,4R)-3-amino-4-[tert-butyl(dimethyl)silyl]oxycyclopentan-1-ol |
| InChIKey | DOBQVWUPIRZKPZ-VXRWAFEHSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(C[C@H]1N)O |
Computed by PubChem (NCBI)