Products 748122-53-4

CAS 748122-53-4 is the registry number for 8-Aminooctanoic Acid Trimethylsilyl Ester. Offered by: TRC. Available pack sizes: 750mg.

Structural formula: {0} (CAS {1})

Trimethylsilyl 8-aminooctanoate (CAS 748122-53-4) is a chemical compound with the molecular formula C11H25NO2Si and a molecular weight of 231.41 g/mol. IUPAC name: trimethylsilyl 8-aminooctanoate. InChIKey: OAYRFAYHKCSCCC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H25NO2Si
Molecular weight231.41 g/mol
IUPAC nametrimethylsilyl 8-aminooctanoate
InChIKeyOAYRFAYHKCSCCC-UHFFFAOYSA-N
SMILESC[Si](C)(C)OC(=O)CCCCCCCN

Computed by PubChem (NCBI)