CAS 2434716-27-3 is the registry number for 2-(3-Bromophenyl)-4,4-dimethyl-4,5-dihydrothiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromophenyl)-4,4-dimethyl-5H-1,3-thiazole (CAS 2434716-27-3) is a chemical compound with the molecular formula C11H12BrNS and a molecular weight of 270.19 g/mol. IUPAC name: 2-(3-bromophenyl)-4,4-dimethyl-5H-1,3-thiazole. InChIKey: MRCBRFCQWOABFJ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNS |
|---|---|
| Molecular weight | 270.19 g/mol |
| IUPAC name | 2-(3-bromophenyl)-4,4-dimethyl-5H-1,3-thiazole |
| InChIKey | MRCBRFCQWOABFJ-UHFFFAOYSA-N |
| SMILES | CC1(CSC(=N1)C2=CC(=CC=C2)Br)C |
Computed by PubChem (NCBI)