CAS 898748-39-5 appears in our catalog under these names: 2-Bromo-6-(1,1-dimethylethyl)benzothiazole, 95%, 2-Bromo-6-(1,1-dimethylethyl)benzothiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
2-bromo-6-tert-butyl-1,3-benzothiazole (CAS 898748-39-5) is a chemical compound with the molecular formula C11H12BrNS and a molecular weight of 270.19 g/mol. IUPAC name: 2-bromo-6-tert-butyl-1,3-benzothiazole. InChIKey: PRXGVHNJTZGGOO-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNS |
|---|---|
| Molecular weight | 270.19 g/mol |
| IUPAC name | 2-bromo-6-tert-butyl-1,3-benzothiazole |
| InChIKey | PRXGVHNJTZGGOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)