CAS 2435610-93-6 is the registry number for PF-07059013. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(1S)-1-(2-amino-6-fluoroquinolin-3-yl)oxyethyl]-5-pyrazol-1-yl-1H-pyridin-2-one (CAS 2435610-93-6) is a chemical compound with the molecular formula C19H16FN5O2 and a molecular weight of 365.4 g/mol. IUPAC name: 6-[(1S)-1-(2-amino-6-fluoroquinolin-3-yl)oxyethyl]-5-pyrazol-1-yl-1H-pyridin-2-one. InChIKey: CLEFVPILGAPOTG-NSHDSACASA-N.
| Molecular formula | C19H16FN5O2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 6-[(1S)-1-(2-amino-6-fluoroquinolin-3-yl)oxyethyl]-5-pyrazol-1-yl-1H-pyridin-2-one |
| InChIKey | CLEFVPILGAPOTG-NSHDSACASA-N |
| SMILES | C[C@@H](C1=C(C=CC(=O)N1)N2C=CC=N2)OC3=C(N=C4C=CC(=CC4=C3)F)N |
Computed by PubChem (NCBI)