CAS 2436275-39-5 is the registry number for 2-(3-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene, 98%, 98%. Offered by: Chemat. Available pack sizes: 10mg.
2-(3-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene (CAS 2436275-39-5) is a chemical compound with the molecular formula C18H14FIS and a molecular weight of 408.3 g/mol. IUPAC name: 2-(3-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene. InChIKey: YXCPJVDQHCCLRJ-UHFFFAOYSA-N.
| Molecular formula | C18H14FIS |
|---|---|
| Molecular weight | 408.3 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene |
| InChIKey | YXCPJVDQHCCLRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)CC2=CC=C(S2)C3=CC(=CC=C3)F |
Computed by PubChem (NCBI)