CAS 243644-28-2 is the registry number for 2-[4-(tert-Butyl)phenyl]-5-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole (CAS 243644-28-2) is a chemical compound with the molecular formula C18H16ClN3O3 and a molecular weight of 357.8 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole. InChIKey: YXXGPTDCYCVDFX-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O3 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-5-(2-chloro-5-nitrophenyl)-1,3,4-oxadiazole |
| InChIKey | YXXGPTDCYCVDFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(O2)C3=C(C=CC(=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)