CAS 2997864-57-8 is the registry number for NLRP3-IN-27. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[1-[(5-chloro-2-methoxyphenyl)methyl]triazol-4-yl]benzoate (CAS 2997864-57-8) is a chemical compound with the molecular formula C18H16ClN3O3 and a molecular weight of 357.8 g/mol. IUPAC name: methyl 4-[1-[(5-chloro-2-methoxyphenyl)methyl]triazol-4-yl]benzoate. InChIKey: XUBLPAZNPKXTRN-UHFFFAOYSA-N.
| Molecular formula | C18H16ClN3O3 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | methyl 4-[1-[(5-chloro-2-methoxyphenyl)methyl]triazol-4-yl]benzoate |
| InChIKey | XUBLPAZNPKXTRN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)CN2C=C(N=N2)C3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)