Products 243666-12-8
CAS 243666-12-8 appears in our catalog under these names: 2–(2，3，4–Trifluorophenyl)acetic acid, 2-(2,3,4-Trifluorophenyl)acetic acid 97%, 2-(2,3,4-trifluorophenyl)acetic acid, 97%, 97%, 2,3,4-Trifluorophenylacetic acid, 2,3,4-Trifluorophenylacetic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, HPC Standards, Fluorochem. Available pack sizes: 10g, 25g, 5g, 500g, 250mg, 1g, 100g, 1x100mg.
2-(2,3,4-trifluorophenyl)acetic acid (CAS 243666-12-8) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2-(2,3,4-trifluorophenyl)acetic acid. InChIKey: OSQPRQRJSJMQRJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2-(2,3,4-trifluorophenyl)acetic acid |
| InChIKey | OSQPRQRJSJMQRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CC(=O)O)F)F)F |
Computed by PubChem (NCBI)