CAS 2437-49-2 appears in our catalog under these names: 2,4,6–Tribromoresorcinol, 2,4,6-Tribromoresorcinol, 98% , 2,4,6-Tribromoresorcinol, >98.0%(GC)(T), 2,4,6-Tribromoresorcinol 98%, 2,4,6-Tribromoresorcinol, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 25g, 100g.
2,4,6-tribromobenzene-1,3-diol (CAS 2437-49-2) is a chemical compound with the molecular formula C6H3Br3O2 and a molecular weight of 346.80 g/mol. IUPAC name: 2,4,6-tribromobenzene-1,3-diol. InChIKey: YADZSMVDNYXOOB-UHFFFAOYSA-N.
| Molecular formula | C6H3Br3O2 |
|---|---|
| Molecular weight | 346.80 g/mol |
| IUPAC name | 2,4,6-tribromobenzene-1,3-diol |
| InChIKey | YADZSMVDNYXOOB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)O)Br)O)Br |
Computed by PubChem (NCBI)