Products 2831355-88-3
CAS 2831355-88-3 is the registry number for Antibacterial synergist 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(bromomethyl)-5-(dibromomethylidene)furan-2-one (CAS 2831355-88-3) is a chemical compound with the molecular formula C6H3Br3O2 and a molecular weight of 346.80 g/mol. IUPAC name: 4-(bromomethyl)-5-(dibromomethylidene)furan-2-one. InChIKey: BYBNEDVDODYDOK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br3O2 |
|---|---|
| Molecular weight | 346.80 g/mol |
| IUPAC name | 4-(bromomethyl)-5-(dibromomethylidene)furan-2-one |
| InChIKey | BYBNEDVDODYDOK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(Br)Br)OC1=O)CBr |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial synergist 2, orb1745037