Products 2438856-42-7

CAS 2438856-42-7 is the registry number for Sofosbuvir Impurity 108. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2S,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl benzoate (CAS 2438856-42-7) is a chemical compound with the molecular formula C20H17FO6 and a molecular weight of 372.3 g/mol. IUPAC name: [(2S,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl benzoate. InChIKey: OUKYMZJNLWKCSO-RZQQEMMASA-N.

Identity
Molecular formulaC20H17FO6
Molecular weight372.3 g/mol
IUPAC name[(2S,3R,4R)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl benzoate
InChIKeyOUKYMZJNLWKCSO-RZQQEMMASA-N
SMILESC[C@]1([C@@H]([C@@H](OC1=O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F

Computed by PubChem (NCBI)