Products 1639833-40-1

CAS 1639833-40-1 is the registry number for Sofosbuvir Impurity 105. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl)methyl benzoate (CAS 1639833-40-1) is a chemical compound with the molecular formula C20H17FO6 and a molecular weight of 372.3 g/mol. IUPAC name: (3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl)methyl benzoate. InChIKey: OUKYMZJNLWKCSO-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17FO6
Molecular weight372.3 g/mol
IUPAC name(3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl)methyl benzoate
InChIKeyOUKYMZJNLWKCSO-UHFFFAOYSA-N
SMILESCC1(C(C(OC1=O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F

Computed by PubChem (NCBI)