Products 1033394-94-3
CAS 1033394-94-3 is the registry number for Sofosbuvir Impurity 88. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl benzoate (CAS 1033394-94-3) is a chemical compound with the molecular formula C20H17FO6 and a molecular weight of 372.3 g/mol. IUPAC name: [(2R,3S,4S)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl benzoate. InChIKey: OUKYMZJNLWKCSO-GUXCAODWSA-N.
| Molecular formula | C20H17FO6 |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | [(2R,3S,4S)-3-benzoyloxy-4-fluoro-4-methyl-5-oxooxolan-2-yl]methyl benzoate |
| InChIKey | OUKYMZJNLWKCSO-GUXCAODWSA-N |
| SMILES | C[C@@]1([C@H]([C@H](OC1=O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)F |
Computed by PubChem (NCBI)