Products 2439-37-4
CAS 2439-37-4 appears in our catalog under these names: (2S)-2-(Dimethylamino)-4-methylpentanoic acid, (S)-2-(Dimethylamino)-4-methylpentanoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 2,5g, 1g, 100mg.
(2S)-2-(dimethylamino)-4-methylpentanoic acid (CAS 2439-37-4) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: (2S)-2-(dimethylamino)-4-methylpentanoic acid. InChIKey: FZLYRJBAUQHHIH-ZETCQYMHSA-N.
| Molecular formula | C8H17NO2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | (2S)-2-(dimethylamino)-4-methylpentanoic acid |
| InChIKey | FZLYRJBAUQHHIH-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-(dimethylamino)-4-methylpentanoic acid, N,N-Dimethyl-l-leucine, L-Leucine, N,N-dimethyl-, (S)-2-(Dimethylamino)-4-methylpentanoic acid, Dimethyl-L-leucine, N,N-Dimethyl-L-leucine HCl, n,n-dimethyl leucine, N-dimethyl-l-leucine, (S)-2-(Dimethylamino)-4-methylpentanoicacid, (S)-2-dimethylamino-4-methyl-pentanoic acid