CAS 2439082-66-1 is the registry number for tert-Butyl (S)-(1,4,5,6-tetrahydrocyclopenta[c]pyrazol-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4S)-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl]carbamate (CAS 2439082-66-1) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-[(4S)-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl]carbamate. InChIKey: CPIXKVAGZNGBFC-QMMMGPOBSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-[(4S)-1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl]carbamate |
| InChIKey | CPIXKVAGZNGBFC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC2=C1C=NN2 |
Computed by PubChem (NCBI)