CAS 24392-26-5 is the registry number for 5-Acetyl-2,6-dimethyl-3,4-dihydropyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
5-acetyl-2,4-dimethyl-1H-pyrimidin-6-one (CAS 24392-26-5) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 5-acetyl-2,4-dimethyl-1H-pyrimidin-6-one. InChIKey: NOESQMJKIYDIFQ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 5-acetyl-2,4-dimethyl-1H-pyrimidin-6-one |
| InChIKey | NOESQMJKIYDIFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=N1)C)C(=O)C |
Computed by PubChem (NCBI)