CAS 243989-47-1 is the registry number for 4-Hydroxy-N-despropyl Ropivacaine. Offered by: TRC. Available pack sizes: 250mg, 25mg.
(2S)-N-(4-hydroxy-2,6-dimethylphenyl)piperidine-2-carboxamide (CAS 243989-47-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: (2S)-N-(4-hydroxy-2,6-dimethylphenyl)piperidine-2-carboxamide. InChIKey: PNGZGTQKSFXTPA-LBPRGKRZSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | (2S)-N-(4-hydroxy-2,6-dimethylphenyl)piperidine-2-carboxamide |
| InChIKey | PNGZGTQKSFXTPA-LBPRGKRZSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)[C@@H]2CCCCN2)C)O |
Computed by PubChem (NCBI)