Products 51989-48-1
CAS 51989-48-1 appears in our catalog under these names: Bupivacaine Impurity 3, Bupivacaine Impurity 15, Bupivacaine Impurity 21, 4-Hydroxy-N-desbutyl Bupivacaine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
N-(4-hydroxy-2,6-dimethylphenyl)piperidine-2-carboxamide (CAS 51989-48-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: N-(4-hydroxy-2,6-dimethylphenyl)piperidine-2-carboxamide. InChIKey: PNGZGTQKSFXTPA-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | N-(4-hydroxy-2,6-dimethylphenyl)piperidine-2-carboxamide |
| InChIKey | PNGZGTQKSFXTPA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1NC(=O)C2CCCCN2)C)O |
Computed by PubChem (NCBI)