Products 2440020-17-5
CAS 2440020-17-5 is the registry number for TERT-BUTYL N-[(1R,3R,4S)-3-HYDROXY-4-(METHYLAMINO)CYCLOPENTYL]CARBAMATE, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate (CAS 2440020-17-5) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate. InChIKey: HEFPQHMDQONQDA-HRDYMLBCSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3R,4S)-3-hydroxy-4-(methylamino)cyclopentyl]carbamate |
| InChIKey | HEFPQHMDQONQDA-HRDYMLBCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]([C@@H](C1)O)NC |
Computed by PubChem (NCBI)