Products 244094-71-1
CAS 244094-71-1 is the registry number for N-Methyl-N,N-bis(2-pyridylethyl)amine-d3. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-pyridin-2-yl-N-(2-pyridin-2-ylethyl)-N-(trideuteriomethyl)ethanamine (CAS 244094-71-1) is a chemical compound with the molecular formula C15H19N3 and a molecular weight of 244.35 g/mol. IUPAC name: 2-pyridin-2-yl-N-(2-pyridin-2-ylethyl)-N-(trideuteriomethyl)ethanamine. InChIKey: PQHKIDBZBKQYMR-FIBGUPNXSA-N.
| Molecular formula | C15H19N3 |
|---|---|
| Molecular weight | 244.35 g/mol |
| IUPAC name | 2-pyridin-2-yl-N-(2-pyridin-2-ylethyl)-N-(trideuteriomethyl)ethanamine |
| InChIKey | PQHKIDBZBKQYMR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC1=CC=CC=N1)CCC2=CC=CC=N2 |
Computed by PubChem (NCBI)