CAS 244132-29-4 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(methylsulfonyl)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylsulfonylpropanoic acid (CAS 244132-29-4) is a chemical compound with the molecular formula C19H19NO6S and a molecular weight of 389.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylsulfonylpropanoic acid. InChIKey: SGRFSKFFNRFQMF-KRWDZBQOSA-N.
| Molecular formula | C19H19NO6S |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylsulfonylpropanoic acid |
| InChIKey | SGRFSKFFNRFQMF-KRWDZBQOSA-N |
| SMILES | CS(=O)(=O)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)