CAS 57912-35-3 appears in our catalog under these names: Z-Cys(z)-oh, 98%, Z-cys(Z)-oh, 98+%, Z–Cys(Z)–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 100g.
(2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoic acid (CAS 57912-35-3) is a chemical compound with the molecular formula C19H19NO6S and a molecular weight of 389.4 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoic acid. InChIKey: PXKPRICKEUGRRR-INIZCTEOSA-N.
| Molecular formula | C19H19NO6S |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)-3-phenylmethoxycarbonylsulfanylpropanoic acid |
| InChIKey | PXKPRICKEUGRRR-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CSC(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)