CAS 24418-92-6 appears in our catalog under these names: 2-Methylpropan-2-aminium tetrafluoroborate, 98%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(2,5-p -xylene)). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
Tert-butylazanium tetrafluoroborate (CAS 24418-92-6) is a chemical compound with the molecular formula C4H12BF4N and a molecular weight of 160.95 g/mol. IUPAC name: tert-butylazanium tetrafluoroborate. InChIKey: ZWINGEZXSQPYLH-UHFFFAOYSA-O.
| Molecular formula | C4H12BF4N |
|---|---|
| Molecular weight | 160.95 g/mol |
| IUPAC name | tert-butylazanium tetrafluoroborate |
| InChIKey | ZWINGEZXSQPYLH-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CC(C)(C)[NH3+] |
Computed by PubChem (NCBI)