CAS 71852-73-8 appears in our catalog under these names: Poly((9,9-dihexylfluorenyl-2,7-diyl)-alt-(9,9'-spirobifluorene-2,7-diyl)), Butylammonium tetrafluoroborate, 98%,RG, 98%,RG. Offered by: Lumtec, Chemat. Available pack sizes: On request, 25g, 1g, 5g, 10g, 50g, 100g.
Butylazanium tetrafluoroborate (CAS 71852-73-8) is a chemical compound with the molecular formula C4H12BF4N and a molecular weight of 160.95 g/mol. IUPAC name: butylazanium tetrafluoroborate. InChIKey: NPRPGAZEBACOGF-UHFFFAOYSA-O.
| Molecular formula | C4H12BF4N |
|---|---|
| Molecular weight | 160.95 g/mol |
| IUPAC name | butylazanium tetrafluoroborate |
| InChIKey | NPRPGAZEBACOGF-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CCCC[NH3+] |
Computed by PubChem (NCBI)