CAS 2442597-47-7 appears in our catalog under these names: 2–(3–Fluoropyridin–4–yl)propan–2–amine hydrochloride, 2-(3-Fluoropyridin-4-yl)propan-2-amine hydrochloride, 95%, 95%, 2-(3-Fluoropyridin-4-yl)propan-2-amine hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g.
2-(3-fluoro-4-pyridinyl)propan-2-amine;hydrochloride (CAS 2442597-47-7) is a chemical compound with the molecular formula C8H12ClFN2 and a molecular weight of 190.64 g/mol. IUPAC name: 2-(3-fluoro-4-pyridinyl)propan-2-amine;hydrochloride. InChIKey: AFAXOWRTIBXJDQ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClFN2 |
|---|---|
| Molecular weight | 190.64 g/mol |
| IUPAC name | 2-(3-fluoro-4-pyridinyl)propan-2-amine;hydrochloride |
| InChIKey | AFAXOWRTIBXJDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=NC=C1)F)N.Cl |
Computed by PubChem (NCBI)