CAS 2689-34-1 appears in our catalog under these names: (4-Amino-2-fluorophenyl)dimethylamine hydrochloride, 95%, (4-Amino-2-fluorophenyl)dimethylamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2-fluoro-1-N,1-N-dimethylbenzene-1,4-diamine;hydrochloride (CAS 2689-34-1) is a chemical compound with the molecular formula C8H12ClFN2 and a molecular weight of 190.64 g/mol. IUPAC name: 2-fluoro-1-N,1-N-dimethylbenzene-1,4-diamine;hydrochloride. InChIKey: LZJRNZUGYJWJIW-UHFFFAOYSA-N.
| Molecular formula | C8H12ClFN2 |
|---|---|
| Molecular weight | 190.64 g/mol |
| IUPAC name | 2-fluoro-1-N,1-N-dimethylbenzene-1,4-diamine;hydrochloride |
| InChIKey | LZJRNZUGYJWJIW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)N)F.Cl |
Computed by PubChem (NCBI)