CAS 2442597-62-6 is the registry number for 4-Amino-5-(trifluoromethyl)isophthalonitrile, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-amino-5-(trifluoromethyl)benzene-1,3-dicarbonitrile (CAS 2442597-62-6) is a chemical compound with the molecular formula C9H4F3N3 and a molecular weight of 211.14 g/mol. IUPAC name: 4-amino-5-(trifluoromethyl)benzene-1,3-dicarbonitrile. InChIKey: WCAPKYFQOKXIGZ-UHFFFAOYSA-N.
| Molecular formula | C9H4F3N3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 4-amino-5-(trifluoromethyl)benzene-1,3-dicarbonitrile |
| InChIKey | WCAPKYFQOKXIGZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)