CAS 888072-96-6 appears in our catalog under these names: 4-Amino-6-(trifluoromethyl)-1,3-benzenedicarbonitrile, Enzalutamide Impurity 49. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
4-amino-6-(trifluoromethyl)benzene-1,3-dicarbonitrile (CAS 888072-96-6) is a chemical compound with the molecular formula C9H4F3N3 and a molecular weight of 211.14 g/mol. IUPAC name: 4-amino-6-(trifluoromethyl)benzene-1,3-dicarbonitrile. InChIKey: XBOGDGSKLKKGAN-UHFFFAOYSA-N.
| Molecular formula | C9H4F3N3 |
|---|---|
| Molecular weight | 211.14 g/mol |
| IUPAC name | 4-amino-6-(trifluoromethyl)benzene-1,3-dicarbonitrile |
| InChIKey | XBOGDGSKLKKGAN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C#N)N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)