CAS 244277-48-3 is the registry number for (R)–ethyl 2–hydroxy–4–oxo–4–phenylbutanoate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Ethyl (2R)-2-hydroxy-4-oxo-4-phenylbutanoate (CAS 244277-48-3) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: ethyl (2R)-2-hydroxy-4-oxo-4-phenylbutanoate. InChIKey: HEWAMPODKFTBJZ-LLVKDONJSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | ethyl (2R)-2-hydroxy-4-oxo-4-phenylbutanoate |
| InChIKey | HEWAMPODKFTBJZ-LLVKDONJSA-N |
| SMILES | CCOC(=O)[C@@H](CC(=O)C1=CC=CC=C1)O |
Computed by PubChem (NCBI)