CAS 244301-59-5 is the registry number for Potassium 1-hexynyltrifluoroborate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Potassium trifluoro(hex-1-ynyl)boranuide (CAS 244301-59-5) is a chemical compound with the molecular formula C6H9BF3K and a molecular weight of 188.04 g/mol. IUPAC name: potassium trifluoro(hex-1-ynyl)boranuide. InChIKey: MGIWEDIHUKYZIG-UHFFFAOYSA-N.
| Molecular formula | C6H9BF3K |
|---|---|
| Molecular weight | 188.04 g/mol |
| IUPAC name | potassium trifluoro(hex-1-ynyl)boranuide |
| InChIKey | MGIWEDIHUKYZIG-UHFFFAOYSA-N |
| SMILES | [B-](C#CCCCC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)