CAS 664374-22-5 is the registry number for Potassium (3,3-dimethylbut-1-yn-1-yl)trifluoroborate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium 3,3-dimethylbut-1-ynyl(trifluoro)boranuide (CAS 664374-22-5) is a chemical compound with the molecular formula C6H9BF3K and a molecular weight of 188.04 g/mol. IUPAC name: potassium 3,3-dimethylbut-1-ynyl(trifluoro)boranuide. InChIKey: APGXHRVAHFVINV-UHFFFAOYSA-N.
| Molecular formula | C6H9BF3K |
|---|---|
| Molecular weight | 188.04 g/mol |
| IUPAC name | potassium 3,3-dimethylbut-1-ynyl(trifluoro)boranuide |
| InChIKey | APGXHRVAHFVINV-UHFFFAOYSA-N |
| SMILES | [B-](C#CC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)