CAS 2444063-48-1 is the registry number for 3-Allyl-5-chloro-1,8-naphthyridine. Offered by: TRC. Available pack sizes: 250mg.
5-chloro-3-prop-2-enyl-1,8-naphthyridine (CAS 2444063-48-1) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 5-chloro-3-prop-2-enyl-1,8-naphthyridine. InChIKey: UCLKXWVTMSQCLY-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 5-chloro-3-prop-2-enyl-1,8-naphthyridine |
| InChIKey | UCLKXWVTMSQCLY-UHFFFAOYSA-N |
| SMILES | C=CCC1=CC2=C(C=CN=C2N=C1)Cl |
Computed by PubChem (NCBI)