CAS 2445347-90-8 appears in our catalog under these names: (S)-Hexahydropyrrolo[1,2-a]pyrazin-6(2H)-one hydrochloride 98%, (S)-Hexahydropyrrolo[1,2-a]pyrazin-6(2H)-one hydrochloride, 97%, 97%, (S)-Hexahydropyrrolo[1,2-a]pyrazin-6(2H)-one hydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 500mg, 10g, 25g.
(8aS)-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride (CAS 2445347-90-8) is a chemical compound with the molecular formula C7H13ClN2O and a molecular weight of 176.64 g/mol. IUPAC name: (8aS)-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride. InChIKey: ZKMZMDVFKFXHKK-RGMNGODLSA-N.
| Molecular formula | C7H13ClN2O |
|---|---|
| Molecular weight | 176.64 g/mol |
| IUPAC name | (8aS)-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride |
| InChIKey | ZKMZMDVFKFXHKK-RGMNGODLSA-N |
| SMILES | C1CC(=O)N2[C@@H]1CNCC2.Cl |
Computed by PubChem (NCBI)