CAS 2445749-80-2 is the registry number for (S)-2-(4,4-Difluoropyrrolidin-2-yl)propan-2-ol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride (CAS 2445749-80-2) is a chemical compound with the molecular formula C7H14ClF2NO and a molecular weight of 201.64 g/mol. IUPAC name: 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride. InChIKey: RSENNMQCDLHFQR-JEDNCBNOSA-N.
| Molecular formula | C7H14ClF2NO |
|---|---|
| Molecular weight | 201.64 g/mol |
| IUPAC name | 2-[(2S)-4,4-difluoropyrrolidin-2-yl]propan-2-ol;hydrochloride |
| InChIKey | RSENNMQCDLHFQR-JEDNCBNOSA-N |
| SMILES | CC(C)([C@@H]1CC(CN1)(F)F)O.Cl |
Computed by PubChem (NCBI)