CAS 2940866-70-4 is the registry number for trans-2-(difluoromethoxy)cyclohexanamine,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Trans-(1R,2R)-2-(difluoromethoxy)cyclohexan-1-amine;hydrochloride (CAS 2940866-70-4) is a chemical compound with the molecular formula C7H14ClF2NO and a molecular weight of 201.64 g/mol. IUPAC name: trans-(1R,2R)-2-(difluoromethoxy)cyclohexan-1-amine;hydrochloride. InChIKey: OOBIVRDUELFJIK-KGZKBUQUSA-N.
| Molecular formula | C7H14ClF2NO |
|---|---|
| Molecular weight | 201.64 g/mol |
| IUPAC name | trans-(1R,2R)-2-(difluoromethoxy)cyclohexan-1-amine;hydrochloride |
| InChIKey | OOBIVRDUELFJIK-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)OC(F)F.Cl |
Computed by PubChem (NCBI)