CAS 2445750-32-1 is the registry number for (R)-1-Cyclohexyl-2,2-difluoroethan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(1R)-1-cyclohexyl-2,2-difluoroethanamine;hydrochloride (CAS 2445750-32-1) is a chemical compound with the molecular formula C8H16ClF2N and a molecular weight of 199.67 g/mol. IUPAC name: (1R)-1-cyclohexyl-2,2-difluoroethanamine;hydrochloride. InChIKey: JREIXGSIHFTAKL-OGFXRTJISA-N.
| Molecular formula | C8H16ClF2N |
|---|---|
| Molecular weight | 199.67 g/mol |
| IUPAC name | (1R)-1-cyclohexyl-2,2-difluoroethanamine;hydrochloride |
| InChIKey | JREIXGSIHFTAKL-OGFXRTJISA-N |
| SMILES | C1CCC(CC1)[C@H](C(F)F)N.Cl |
Computed by PubChem (NCBI)